CAS 1256786-84-1

6-Chloro-3-cyano-2-pyridinecarboxylic acid

Description:

6-Chloro-3-cyano-2-pyridinecarboxylic acid is a heterocyclic organic compound characterized by the presence of a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chloro substituent at the 6-position and a cyano group at the 3-position, along with a carboxylic acid functional group at the 2-position. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The chloro group can enhance the compound's electrophilicity, while the cyano group may participate in nucleophilic reactions. Additionally, the carboxylic acid group can engage in hydrogen bonding, influencing the compound's solubility and interaction with biological systems. Overall, 6-Chloro-3-cyano-2-pyridinecarboxylic acid is a versatile compound with potential utility in synthetic organic chemistry and medicinal chemistry.

Formula: C₇H₃ClN₂O₂

InChI: InChI=1S/C7H3ClN2O2/c8-5-2-1-4(3-9)6(10-5)7(11)12/h1-2H,(H,11,12)

InChI key: InChIKey=CUBILUUJPWXTPJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C#N)C=CC(Cl)=N1

Synonyms:

• 6-Chloro-3-cyano-2-pyridinecarboxylic acid
• 2-Pyridinecarboxylic acid, 6-chloro-3-cyano-