CAS 1256788-22-3

3-Hydroxy-4-methyl-2-pyridinecarboxylic acid

Description:

3-Hydroxy-4-methyl-2-pyridinecarboxylic acid, also known as a derivative of pyridine, is characterized by its functional groups, which include a hydroxyl group (-OH) and a carboxylic acid group (-COOH) attached to a pyridine ring. This compound typically exhibits properties such as solubility in polar solvents due to the presence of the hydroxyl and carboxylic acid groups, which can engage in hydrogen bonding. The methyl group at the 4-position contributes to its hydrophobic character, influencing its overall solubility and reactivity. As a pyridine derivative, it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. The presence of the hydroxyl group can also enhance its acidity compared to other pyridine derivatives. This compound may have applications in pharmaceuticals, agrochemicals, or as a biochemical probe due to its structural features. Its specific reactivity and applications would depend on the context of its use and the presence of other functional groups in related compounds.

Formula: C₇H₇NO₃

InChI: InChI=1S/C7H7NO3/c1-4-2-3-8-5(6(4)9)7(10)11/h2-3,9H,1H3,(H,10,11)

InChI key: InChIKey=FGIOYVALQZKTOU-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(O)C(C)=CC=N1

Synonyms:

• 2-Pyridinecarboxylic acid, 3-hydroxy-4-methyl-
• 3-Hydroxy-4-methyl-2-pyridinecarboxylic acid

3-Hydroxy-4-methylpyridine-2-carboxylic acid

CAS: 1256788-22-3

Please enquire for more information about 3-Hydroxy-4-methylpyridine-2-carboxylic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₇H₇NO₃

Purity: Min. 95%

Molecular weight: 153.14 g/mol

Ref: 3D-GAC78822