
CAS 1256789-02-2
:2-Bromo-4-fluoro-5-methoxypyridine
Description:
2-Bromo-4-fluoro-5-methoxypyridine is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2, 4, and 5 positions. The presence of bromine and fluorine atoms introduces significant electronegativity and reactivity, influencing the compound's chemical behavior and potential applications. The methoxy group at the 5-position enhances solubility and can participate in various chemical reactions, making it a versatile building block in organic synthesis. This compound is typically used in pharmaceutical research and development due to its potential biological activity. Its molecular structure contributes to its properties, such as polarity and reactivity, which are essential for interactions in biological systems. Additionally, the presence of halogens can affect the compound's stability and reactivity, making it a subject of interest in medicinal chemistry. Safety data sheets should be consulted for handling and storage guidelines, as halogenated compounds can pose health and environmental risks. Overall, 2-Bromo-4-fluoro-5-methoxypyridine is a significant compound in the field of organic chemistry and drug discovery.
Formula:C6H5BrFNO
InChI:InChI=1S/C6H5BrFNO/c1-10-5-3-9-6(7)2-4(5)8/h2-3H,1H3
InChI key:InChIKey=QJGXFQTUQLXNBO-UHFFFAOYSA-N
SMILES:O(C)C=1C(F)=CC(Br)=NC1
Synonyms:- 2-Bromo-4-fluoro-5-methoxypyridine
- Pyridine, 2-bromo-4-fluoro-5-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.