CymitQuimica logo

CAS 1256789-38-4

:

6-(1H-Imidazol-2-yl)-3-pyridinol

Description:
6-(1H-Imidazol-2-yl)-3-pyridinol, identified by its CAS number 1256789-38-4, is a heterocyclic organic compound featuring both imidazole and pyridine rings in its structure. This compound typically exhibits characteristics common to nitrogen-containing heterocycles, such as potential basicity due to the presence of nitrogen atoms, which can participate in hydrogen bonding and coordination with metal ions. It may display moderate to high solubility in polar solvents, influenced by its functional groups. The compound is of interest in medicinal chemistry, particularly for its potential biological activities, which may include antimicrobial or anticancer properties. Its structural features allow for interactions with biological targets, making it a candidate for drug development. Additionally, the presence of both the imidazole and pyridine moieties may contribute to its reactivity and stability under various conditions. As with many heterocycles, the specific properties can vary based on the substituents and the environment in which the compound is studied.
Formula:C8H7N3O
InChI:InChI=1S/C8H7N3O/c12-6-1-2-7(11-5-6)8-9-3-4-10-8/h1-5,12H,(H,9,10)
InChI key:InChIKey=NGPLVEBKTUJLQI-UHFFFAOYSA-N
SMILES:OC1=CC=C(N=C1)C=2NC=CN2
Synonyms:
  • 6-(1H-Imidazol-2-yl)-3-pyridinol
  • 3-Pyridinol, 6-(1H-imidazol-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.