
CAS 1256789-45-3
:4-Bromo-3-methoxy-2-pyridinecarboxylic acid
Description:
4-Bromo-3-methoxy-2-pyridinecarboxylic acid is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 4-position and a methoxy group at the 3-position contributes to its unique chemical properties. This compound features a carboxylic acid functional group at the 2-position, which imparts acidity and enhances its reactivity in various chemical reactions. The methoxy group can influence the compound's solubility and polarity, making it more hydrophilic compared to other pyridine derivatives. Additionally, the bromine substituent can serve as a site for further chemical modifications, such as nucleophilic substitution reactions. This compound may be of interest in medicinal chemistry and material science due to its potential biological activity and utility in synthesizing other complex molecules. Its specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or literature reference for precise values.
Formula:C7H6BrNO3
InChI:InChI=1S/C7H6BrNO3/c1-12-6-4(8)2-3-9-5(6)7(10)11/h2-3H,1H3,(H,10,11)
InChI key:InChIKey=LZRALLBGSZSZFI-UHFFFAOYSA-N
SMILES:O(C)C1=C(C(O)=O)N=CC=C1Br
Synonyms:- 4-Bromo-3-methoxy-2-pyridinecarboxylic acid
- 2-Pyridinecarboxylic acid, 4-bromo-3-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.