
CAS 1256789-64-6
:5-Ethoxy-3-pyridinemethanamine
Description:
5-Ethoxy-3-pyridinemethanamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features an ethoxy group (-OCH2CH3) and an amine group (-NH2) attached to the pyridine structure, influencing its chemical reactivity and solubility. The presence of the ethoxy group enhances its lipophilicity, potentially affecting its biological activity and interaction with various receptors or enzymes. The amine functionality can participate in hydrogen bonding, making it a candidate for various applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound's structure suggests potential for diverse synthetic modifications, allowing for the exploration of structure-activity relationships. Its CAS number, 1256789-64-6, provides a unique identifier for regulatory and research purposes. Overall, 5-Ethoxy-3-pyridinemethanamine exhibits characteristics typical of pyridine derivatives, including potential basicity and reactivity, which can be leveraged in various chemical and biological contexts.
Formula:C8H12N2O
InChI:InChI=1S/C8H12N2O/c1-2-11-8-3-7(4-9)5-10-6-8/h3,5-6H,2,4,9H2,1H3
InChI key:InChIKey=OFCRDLNLLQTVJO-UHFFFAOYSA-N
SMILES:O(CC)C=1C=C(CN)C=NC1
Synonyms:- 3-Pyridinemethanamine, 5-ethoxy-
- 5-Ethoxy-3-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.