CymitQuimica logo

CAS 1256789-70-4

:

3-Bromo-2-fluoro-4-methoxypyridine

Description:
3-Bromo-2-fluoro-4-methoxypyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of bromine and fluorine substituents at the 3 and 2 positions, respectively, along with a methoxy group at the 4 position, contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It exhibits moderate polarity due to the electronegative halogen atoms and the methoxy group, which can influence its solubility in various organic solvents. The compound may participate in nucleophilic substitution reactions due to the presence of the halogen atoms, making it useful in synthetic organic chemistry. Additionally, its structural features suggest potential applications in pharmaceuticals or agrochemicals, where such functional groups can enhance biological activity or selectivity. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C6H5BrFNO
InChI:InChI=1S/C6H5BrFNO/c1-10-4-2-3-9-6(8)5(4)7/h2-3H,1H3
InChI key:InChIKey=IUQDKFOVYIWFEL-UHFFFAOYSA-N
SMILES:O(C)C=1C(Br)=C(F)N=CC1
Synonyms:
  • Pyridine, 3-bromo-2-fluoro-4-methoxy-
  • 3-Bromo-2-fluoro-4-methoxypyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.