
CAS 1256789-77-1
:5-Cyano-2-methyl-3-pyridinecarboxylic acid
Description:
5-Cyano-2-methyl-3-pyridinecarboxylic acid is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a cyano group (-CN) and a carboxylic acid group (-COOH) attached to the pyridine ring, contributing to its acidic properties and potential reactivity. The presence of the methyl group (-CH3) at the 2-position of the pyridine enhances its lipophilicity, which can influence its solubility in organic solvents. The cyano group introduces a strong electron-withdrawing effect, which can affect the compound's reactivity in various chemical reactions, such as nucleophilic substitutions or cycloadditions. This compound may find applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis due to its functional groups. Its specific physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable chemical databases for precise applications.
Formula:C8H6N2O2
InChI:InChI=1S/C8H6N2O2/c1-5-7(8(11)12)2-6(3-9)4-10-5/h2,4H,1H3,(H,11,12)
InChI key:InChIKey=SOMNHSWRZODVSQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C#N)C=NC1C
Synonyms:- 5-Cyano-2-methyl-3-pyridinecarboxylic acid
- 5-Cyano-2-methylnicotinic acid
- 3-Pyridinecarboxylic acid, 5-cyano-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.