CymitQuimica logo

CAS 1256790-34-7

:

5-Chloro-4-methoxy-3-pyridinamine

Description:
5-Chloro-4-methoxy-3-pyridinamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 5-position and a methoxy group at the 4-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar organic solvents due to the presence of the methoxy group, which enhances its polarity. The amino group at the 3-position can participate in hydrogen bonding, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Its structure suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. Additionally, the chlorine substituent may influence its reactivity and biological activity, making it a subject of interest in medicinal chemistry. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact.
Formula:C6H7ClN2O
InChI:InChI=1S/C6H7ClN2O/c1-10-6-4(7)2-9-3-5(6)8/h2-3H,8H2,1H3
InChI key:InChIKey=MAHHPBZNYOVLPP-UHFFFAOYSA-N
SMILES:O(C)C=1C(Cl)=CN=CC1N
Synonyms:
  • 3-Pyridinamine, 5-chloro-4-methoxy-
  • 5-Chloro-4-methoxy-3-pyridinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.