CAS 1256790-51-8

4-Bromo-5-chloro-2-pyridinecarboxaldehyde

Description:

4-Bromo-5-chloro-2-pyridinecarboxaldehyde is an organic compound characterized by its heterocyclic structure, which includes a pyridine ring substituted with both bromine and chlorine atoms, as well as an aldehyde functional group. The presence of these halogen substituents can influence the compound's reactivity, polarity, and overall chemical behavior. Typically, compounds like this exhibit moderate to high solubility in polar organic solvents due to the electronegative halogens and the aldehyde group, which can participate in hydrogen bonding. The aldehyde functional group is reactive, making this compound useful in various synthetic applications, including the formation of more complex molecules through nucleophilic addition reactions. Additionally, the specific arrangement of the substituents on the pyridine ring can affect the compound's electronic properties, potentially making it a candidate for applications in pharmaceuticals or agrochemicals. Safety data should be consulted, as halogenated compounds can pose health risks and environmental concerns.

Formula: C₆H₃BrClNO

InChI: InChI=1S/C6H3BrClNO/c7-5-1-4(3-10)9-2-6(5)8/h1-3H

InChI key: InChIKey=CBTWGUQMNVUMOK-UHFFFAOYSA-N

SMILES: C(=O)C1=CC(Br)=C(Cl)C=N1

Synonyms:

• 2-Pyridinecarboxaldehyde, 4-bromo-5-chloro-
• 4-Bromo-5-chloro-2-pyridinecarboxaldehyde