CAS 1256790-69-8

2-Pyridinecarboxaldehyde, 3,5-dimethoxy-

Description:

2-Pyridinecarboxaldehyde, 3,5-dimethoxy- is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an aldehyde functional group (-CHO) attached to the pyridine ring, specifically at the 2-position, and two methoxy groups (-OCH3) at the 3 and 5 positions. The presence of these methoxy groups enhances the compound's solubility in organic solvents and can influence its reactivity and interaction with biological systems. The molecular structure contributes to its potential applications in various fields, including pharmaceuticals and agrochemicals, where it may serve as an intermediate or a building block for more complex molecules. Additionally, the compound's properties, such as boiling point, melting point, and spectral characteristics, are influenced by the functional groups present, making it a subject of interest for further research in synthetic organic chemistry.

Formula: C₈H₉NO₃

InChI: InChI=1S/C8H9NO3/c1-11-6-3-8(12-2)7(5-10)9-4-6/h3-5H,1-2H3

InChI key: InChIKey=ZTGUWYBOBMWZJX-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=O)N=CC(OC)=C1

Synonyms:

• 2-Pyridinecarboxaldehyde, 3,5-dimethoxy-
• 3,5-Dimethoxy-2-Pyridinecarboxaldehyde