CAS 1256790-79-0

Methyl 5-chloro-4-methyl-2-pyridinecarboxylate

Description:

Methyl 5-chloro-4-methyl-2-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a methyl ester functional group, indicating that it is a derivative of a carboxylic acid. The presence of chlorine and additional methyl groups on the pyridine ring contributes to its unique chemical properties, including potential reactivity and solubility characteristics. Typically, compounds like this may exhibit moderate polarity due to the ester and halogen substituents, influencing their solubility in various organic solvents. The chlorine atom can also impart specific reactivity, making it a potential candidate for further chemical transformations. Methyl 5-chloro-4-methyl-2-pyridinecarboxylate may find applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, owing to the functional groups present that can participate in various chemical reactions. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₈H₈ClNO₂

InChI: InChI=1S/C8H8ClNO2/c1-5-3-7(8(11)12-2)10-4-6(5)9/h3-4H,1-2H3

InChI key: InChIKey=NFBXFCOGFKVJQC-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=CC(C)=C(Cl)C=N1

Synonyms:

• Methyl 5-chloro-4-methyl-2-pyridinecarboxylate
• 2-Pyridinecarboxylic acid, 5-chloro-4-methyl-, methyl ester