CymitQuimica logo

CAS 1256790-91-6

:

6-Ethynyl-1H-pyrrolo[3,2-b]pyridine

Description:
6-Ethynyl-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyridine ring fused to a pyrrole ring, with an ethynyl group attached at the 6-position. This compound is notable for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The presence of the ethynyl group enhances its reactivity and may facilitate further chemical modifications. Additionally, the compound exhibits properties typical of nitrogen-containing heterocycles, such as basicity and the ability to participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Its molecular structure contributes to its stability and solubility characteristics, which are important for its behavior in biological systems and synthetic applications. Overall, 6-Ethynyl-1H-pyrrolo[3,2-b]pyridine represents a valuable scaffold in organic synthesis and drug discovery.
Formula:C9H6N2
InChI:InChI=1S/C9H6N2/c1-2-7-5-9-8(11-6-7)3-4-10-9/h1,3-6,10H
InChI key:InChIKey=MHDBZOMBGCHBKI-UHFFFAOYSA-N
SMILES:C(#C)C=1C=C2C(=NC1)C=CN2
Synonyms:
  • 1H-Pyrrolo[3,2-b]pyridine, 6-ethynyl-
  • 6-Ethynyl-1H-pyrrolo[3,2-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.