
CAS 1256791-14-6
:5-Chloro-3-fluoro-2-pyridinemethanamine
Description:
5-Chloro-3-fluoro-2-pyridinemethanamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. The presence of chlorine and fluorine substituents at the 5 and 3 positions, respectively, contributes to its unique chemical properties, including potential reactivity and polarity. The amine functional group attached to the pyridine ring enhances its basicity and ability to form hydrogen bonds, making it a candidate for various chemical reactions, including nucleophilic substitutions. This compound may exhibit biological activity, potentially serving as a building block in pharmaceutical synthesis or agrochemical applications. Its molecular structure suggests that it could interact with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of halogens can influence its solubility and stability in different solvents. As with many nitrogen-containing heterocycles, it may also participate in coordination chemistry, forming complexes with metal ions. Overall, 5-Chloro-3-fluoro-2-pyridinemethanamine presents a versatile framework for further chemical exploration and application.
Formula:C6H6ClFN2
InChI:InChI=1S/C6H6ClFN2/c7-4-1-5(8)6(2-9)10-3-4/h1,3H,2,9H2
InChI key:InChIKey=VJWGDXIMZSUCJE-UHFFFAOYSA-N
SMILES:C(N)C1=C(F)C=C(Cl)C=N1
Synonyms:- 1-(5-Chloro-3-fluoropyridin-2-yl)methanamine
- 5-Chloro-3-fluoro-2-pyridinemethanamine
- 2-Pyridinemethanamine, 5-chloro-3-fluoro-
- (5-Chloro-3-fluoropyridin-2-yl)methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.