CymitQuimica logo

CAS 1256792-02-5

:

5-Bromo-2-(1-methylethyl)-3-pyridinol

Description:
5-Bromo-2-(1-methylethyl)-3-pyridinol is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and an isopropyl group at the 2-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and exhibits moderate solubility in polar solvents due to the hydroxyl group (-OH) at the 3-position, which can engage in hydrogen bonding. The bromine substituent can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the isopropyl group may affect the steric hindrance and overall molecular interactions. 5-Bromo-2-(1-methylethyl)-3-pyridinol may find applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. As with many organic compounds, safety data and handling precautions should be considered when working with this substance.
Formula:C8H10BrNO
InChI:InChI=1S/C8H10BrNO/c1-5(2)8-7(11)3-6(9)4-10-8/h3-5,11H,1-2H3
InChI key:InChIKey=GDDCMORDYPFPGR-UHFFFAOYSA-N
SMILES:C(C)(C)C1=C(O)C=C(Br)C=N1
Synonyms:
  • 3-Pyridinol, 5-bromo-2-(1-methylethyl)-
  • 5-Bromo-2-(1-methylethyl)-3-pyridinol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.