CAS 1256792-43-4

6-Ethynyl-3-fluoro-2-methylpyridine

Description:

6-Ethynyl-3-fluoro-2-methylpyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of an ethynyl group at the 6-position introduces a triple bond, contributing to its reactivity and potential applications in organic synthesis. The 3-fluoro substituent enhances its electronic properties, potentially influencing its behavior in chemical reactions and interactions with biological targets. The 2-methyl group adds steric bulk, which can affect the compound's solubility and overall stability. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its unique structure allows for various synthetic modifications, which can lead to the development of derivatives with tailored properties. As with many pyridine derivatives, it may participate in nucleophilic and electrophilic reactions, making it valuable in the synthesis of more complex organic molecules. Safety and handling precautions should be observed due to the potential hazards associated with its chemical reactivity.

Formula: C₈H₆FN

InChI: InChI=1S/C8H6FN/c1-3-7-4-5-8(9)6(2)10-7/h1,4-5H,2H3

InChI key: InChIKey=WADOFTVDZARAFC-UHFFFAOYSA-N

SMILES: C(#C)C=1N=C(C)C(F)=CC1

Synonyms:

• 6-Ethynyl-3-fluoro-2-methylpyridine
• Pyridine, 6-ethynyl-3-fluoro-2-methyl-