CAS 1256792-52-5

1-(3-Fluoro-6-methyl-2-pyridinyl)ethanone

Description:

1-(3-Fluoro-6-methyl-2-pyridinyl)ethanone, identified by its CAS number 1256792-52-5, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a fluorine atom at the 3-position and a methyl group at the 6-position of the pyridine ring contributes to its unique chemical properties and reactivity. The ethanone functional group indicates that the compound contains a carbonyl group (C=O) adjacent to an ethyl group, which can influence its reactivity in various chemical reactions, such as nucleophilic attacks. This compound may exhibit polar characteristics due to the electronegative fluorine atom and the carbonyl group, potentially affecting its solubility in different solvents. Additionally, the presence of the pyridine ring may impart basicity and influence the compound's interaction with biological systems, making it of interest in medicinal chemistry and drug development. Overall, its structural features suggest potential applications in pharmaceuticals or agrochemicals.

Formula: C₈H₈FNO

InChI: InChI=1S/C8H8FNO/c1-5-3-4-7(9)8(10-5)6(2)11/h3-4H,1-2H3

InChI key: InChIKey=BPUDMFAFFCPKSF-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=C(F)C=CC(C)=N1

Synonyms:

• Ethanone, 1-(3-fluoro-6-methyl-2-pyridinyl)-
• 1-(3-Fluoro-6-methyl-2-pyridinyl)ethanone