
CAS 1256792-54-7
:6-Fluoro-3-methyl-2-pyridinecarboxaldehyde
Description:
6-Fluoro-3-methyl-2-pyridinecarboxaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. The presence of a fluorine atom at the 6-position and a methyl group at the 3-position contributes to its unique chemical properties. The aldehyde functional group, located at the 2-position, makes it a reactive compound, particularly in nucleophilic addition reactions. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is soluble in organic solvents, which enhances its utility in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. The presence of the fluorine atom can influence the compound's electronic properties, potentially enhancing its biological activity or altering its reactivity. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.
Formula:C7H6FNO
InChI:InChI=1S/C7H6FNO/c1-5-2-3-7(8)9-6(5)4-10/h2-4H,1H3
InChI key:InChIKey=KBHAFGRIDCRCJK-UHFFFAOYSA-N
SMILES:C(=O)C1=C(C)C=CC(F)=N1
Synonyms:- 2-Pyridinecarboxaldehyde, 6-fluoro-3-methyl-
- 6-Fluoro-3-methyl-2-pyridinecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.