CAS 1256792-70-7

5-Cyano-3-pyridinepropanoic acid

Description:

5-Cyano-3-pyridinepropanoic acid is an organic compound characterized by its pyridine ring and a cyano group attached to a propanoic acid moiety. This compound features a pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom, contributing to its unique chemical properties. The presence of the cyano group (-C≡N) enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and cycloadditions. The carboxylic acid functional group (-COOH) provides acidic properties, allowing it to participate in acid-base reactions. This compound is of interest in medicinal chemistry and material science due to its potential applications in drug development and as a building block for synthesizing more complex molecules. Its solubility and stability in various solvents can vary, influencing its practical applications. Overall, 5-Cyano-3-pyridinepropanoic acid is a versatile compound with significant implications in chemical research and development.

Formula: C₉H₈N₂O₂

InChI: InChI=1S/C9H8N2O2/c10-4-8-3-7(5-11-6-8)1-2-9(12)13/h3,5-6H,1-2H2,(H,12,13)

InChI key: InChIKey=RQQCMMVWTVYEII-UHFFFAOYSA-N

SMILES: C(CC(O)=O)C=1C=C(C#N)C=NC1

Synonyms:

• 3-Pyridinepropanoic acid, 5-cyano-
• 5-Cyano-3-pyridinepropanoic acid