
CAS 1256793-74-4
:7-(Trifluoromethyl)-1H-pyrazolo[4,3-c]pyridine
Description:
7-(Trifluoromethyl)-1H-pyrazolo[4,3-c]pyridine is a heterocyclic compound characterized by its unique pyrazolo-pyridine structure, which incorporates a trifluoromethyl group at the 7-position. This compound features a fused ring system that contributes to its chemical stability and potential reactivity. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of new drugs targeting various biological pathways. Additionally, the presence of fluorine atoms often imparts unique electronic properties, which can be advantageous in fine-tuning the pharmacokinetic and pharmacodynamic profiles of drug candidates. Overall, 7-(Trifluoromethyl)-1H-pyrazolo[4,3-c]pyridine represents a valuable scaffold in the exploration of novel therapeutic agents.
Formula:C7H4F3N3
InChI:InChI=1S/C7H4F3N3/c8-7(9,10)5-3-11-1-4-2-12-13-6(4)5/h1-3H,(H,12,13)
InChI key:InChIKey=FXGYCCBUSFVGSN-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C2C(=CN=C1)C=NN2
Synonyms:- 7-(Trifluoromethyl)-1H-pyrazolo[4,3-c]pyridine
- 1H-Pyrazolo[4,3-c]pyridine, 7-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.