
CAS 1256794-01-0
:5-Fluorofuro[2,3-b]pyridin-3(2H)-one
Description:
5-Fluorofuro[2,3-b]pyridin-3(2H)-one is a heterocyclic organic compound characterized by its fused furan and pyridine rings, with a fluorine substituent at the 5-position of the furan moiety. This compound typically exhibits a pale to light-colored appearance and is soluble in organic solvents, reflecting its aromatic nature. The presence of the fluorine atom can influence its chemical reactivity, stability, and biological activity, often enhancing lipophilicity and altering pharmacokinetic properties. The compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with various biological targets, which can be explored in the context of therapeutic applications. Additionally, the compound's synthesis and characterization involve standard organic chemistry techniques, including NMR and mass spectrometry for confirmation of its structure. Overall, 5-Fluorofuro[2,3-b]pyridin-3(2H)-one represents a valuable scaffold in the exploration of new chemical entities.
Formula:C7H4FNO2
InChI:InChI=1S/C7H4FNO2/c8-4-1-5-6(10)3-11-7(5)9-2-4/h1-2H,3H2
InChI key:InChIKey=WSYCSHLPQWLBPN-UHFFFAOYSA-N
SMILES:O=C1C=2C(=NC=C(F)C2)OC1
Synonyms:- Furo[2,3-b]pyridin-3(2H)-one, 5-fluoro-
- 5-Fluorofuro[2,3-b]pyridin-3(2H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.