CAS 1256794-28-1
:4,6-Dichloro-1H-pyrazolo[4,3-c]pyridine
Description:
4,6-Dichloro-1H-pyrazolo[4,3-c]pyridine is a heterocyclic compound characterized by its pyrazolo and pyridine rings, which contribute to its unique chemical properties. This substance features two chlorine atoms at the 4 and 6 positions of the pyrazolo ring, enhancing its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of chlorine substituents can influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. This compound is of interest in medicinal chemistry and material science due to its potential applications in drug development and as a building block for more complex molecules. Its molecular structure allows for interactions with biological targets, which may lead to pharmacological effects. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C6H3Cl2N3
InChI:InChI=1S/C6H3Cl2N3/c7-5-1-4-3(2-9-11-4)6(8)10-5/h1-2H,(H,9,11)
InChI key:ANKNVJSQPOPDLR-UHFFFAOYSA-N
SMILES:C1=C2C(=C(N=C1Cl)Cl)C=NN2
Synonyms:- 1H-Pyrazolo[4,3-c]pyridine, 4,6-dichloro-
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
4,6-Dichloro-1H-pyrazolo[4,3-c]pyridine
CAS:4,6-Dichloro-1H-pyrazolo[4,3-c]pyridineFormula:C6H3Cl2N3Purity:99%Color and Shape:SolidMolecular weight:188.014124,6-Dichloro-1H-pyrazolo[4,3-c]pyridine
CAS:Formula:C6H3Cl2N3Purity:97%Color and Shape:SolidMolecular weight:188.0141Ref: IN-DA000OCZ
25gTo inquire100mg43.00€250mg62.00€1g109.00€5g287.00€10g383.00€50g1,122.00€100g1,907.00€250g3,813.00€4,6-Dichloro-1H-pyrazolo[4,3-c]pyridine
CAS:4,6-Dichloro-1H-pyrazolo[4,3-c]pyridineFormula:C6H3Cl2N3Purity:98%Molecular weight:188.014,6-Dichloro-1H-pyrazolo[4,3-c]pyridine
CAS:Formula:C6H3Cl2N3Purity:95%Color and Shape:SolidMolecular weight:188.014,6-Dichloro-1H-pyrazolo[4,3-c]pyridine
CAS:4,6-Dichloro-1H-pyrazolo[4,3-c]pyridine is a reagent that has been used as a building block for the synthesis of other compounds. It is also used in the preparation of a variety of organic compounds. 4,6-Dichloro-1H-pyrazolo[4,3-c]pyridine is soluble in organic solvents such as chloroform and ethanol, and can be stored at room temperature. This compound reacts with acids to produce an acid chloride that are useful for the formation of amides and esters. This product has been shown to have a high quality and is suitable for use in research or development.Formula:C6H3Cl2N3Purity:Min. 95%Color and Shape:Yellow to beige solid.Molecular weight:188.01 g/mol




