CAS 1256803-65-2

2-Chloro-5,6,7,8-tetrahydro-7-(phenylmethyl)-1,7-naphthyridine

Description:

2-Chloro-5,6,7,8-tetrahydro-7-(phenylmethyl)-1,7-naphthyridine is a chemical compound characterized by its complex bicyclic structure, which includes a naphthyridine core. This compound features a chlorine atom at the 2-position and a phenylmethyl group at the 7-position, contributing to its unique reactivity and potential biological activity. The tetrahydro configuration indicates the presence of four hydrogen atoms that saturate the ring system, enhancing its stability and solubility in organic solvents. The presence of the chlorine substituent can influence the compound's electronic properties, potentially affecting its interactions with biological targets. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting specific receptors or enzymes. As with many organic compounds, its behavior in various environments, including solubility, stability, and reactivity, will depend on factors such as pH, temperature, and the presence of other chemical species.

Formula: C₁₅H₁₅ClN₂

InChI: InChI=1S/C15H15ClN2/c16-15-7-6-13-8-9-18(11-14(13)17-15)10-12-4-2-1-3-5-12/h1-7H,8-11H2

InChI key: InChIKey=ZJPIURPZEMYVIH-UHFFFAOYSA-N

SMILES: C(N1CC=2C(CC1)=CC=C(Cl)N2)C3=CC=CC=C3

Synonyms:

• 1,7-Naphthyridine, 2-chloro-5,6,7,8-tetrahydro-7-(phenylmethyl)-
• 7-Benzyl-2-chloro-5,6,7,8-tetrahydro-1,7-naphthyridine
• 2-Chloro-5,6,7,8-tetrahydro-7-(phenylmethyl)-1,7-naphthyridine