CAS 1256804-62-2

5,6,7,8-Tetrahydro-8-quinolinecarboxylic acid

Description:

5,6,7,8-Tetrahydro-8-quinolinecarboxylic acid is a bicyclic compound characterized by its quinoline structure, which features a fused ring system comprising a benzene ring and a pyridine ring. This compound is notable for its tetrahydro configuration, indicating the presence of four hydrogen atoms that saturate the rings, contributing to its stability and reactivity. The carboxylic acid functional group (-COOH) attached to the quinoline framework imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility and reactivity can vary depending on the solvent and conditions, and it may interact with biological targets due to its structural features. As with many organic compounds, proper handling and safety measures should be observed, particularly in laboratory settings. Overall, 5,6,7,8-Tetrahydro-8-quinolinecarboxylic acid represents a versatile structure with potential applications in various fields of chemistry and pharmacology.

Formula: C₁₀H₁₁NO₂

InChI: InChI=1S/C10H11NO2/c12-10(13)8-5-1-3-7-4-2-6-11-9(7)8/h2,4,6,8H,1,3,5H2,(H,12,13)

InChI key: InChIKey=CKRJUOUVEIKEQX-UHFFFAOYSA-N

SMILES: C(O)(=O)C1C=2C(CCC1)=CC=CN2

Synonyms:

• 8-Quinolinecarboxylic acid, 5,6,7,8-tetrahydro-
• 5,6,7,8-Tetrahydro-8-quinolinecarboxylic acid