CymitQuimica logo

CAS 1256804-63-3

:

3-Bromo-4-methoxy-5-(trifluoromethyl)pyridine

Description:
3-Bromo-4-methoxy-5-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 3-position, a methoxy group (-OCH3) at the 4-position, and a trifluoromethyl group (-CF3) at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents. The trifluoromethyl group enhances its lipophilicity and can influence its reactivity and biological activity. The methoxy group can participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. Additionally, the bromine atom can serve as a leaving group in reactions, making this compound useful in synthetic organic chemistry. Overall, 3-Bromo-4-methoxy-5-(trifluoromethyl)pyridine is of interest in pharmaceutical and agrochemical research due to its potential applications in drug development and as a building block in organic synthesis.
Formula:C7H5BrF3NO
InChI:InChI=1S/C7H5BrF3NO/c1-13-6-4(7(9,10)11)2-12-3-5(6)8/h2-3H,1H3
InChI key:InChIKey=DCJXZFDKBKRFHR-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C(OC)=C(Br)C=NC1
Synonyms:
  • Pyridine, 3-bromo-4-methoxy-5-(trifluoromethyl)-
  • 3-Bromo-4-methoxy-5-(trifluoromethyl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.