CymitQuimica logo

CAS 1256805-06-7

:

2,4-Dibromo-5-fluoropyridine

Description:
2,4-Dibromo-5-fluoropyridine is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2 and 4 positions with bromine atoms and at the 5 position with a fluorine atom. This compound typically appears as a colorless to light yellow liquid or solid, depending on its physical state at room temperature. It is known for its potential applications in pharmaceuticals and agrochemicals due to the presence of halogen substituents, which can enhance biological activity and reactivity. The presence of bromine and fluorine atoms contributes to its unique chemical properties, such as increased lipophilicity and potential for forming hydrogen bonds. 2,4-Dibromo-5-fluoropyridine is also of interest in synthetic organic chemistry for its utility in various reactions, including nucleophilic substitutions and coupling reactions. As with many halogenated compounds, it is important to handle this substance with care due to potential toxicity and environmental concerns associated with halogenated organic compounds.
Formula:C5H2Br2FN
InChI:InChI=1S/C5H2Br2FN/c6-3-1-5(7)9-2-4(3)8/h1-2H
InChI key:InChIKey=ZKWTVVXHWYTWJT-UHFFFAOYSA-N
SMILES:BrC=1C(F)=CN=C(Br)C1
Synonyms:
  • Pyridine, 2,4-dibromo-5-fluoro-
  • 2,4-Dibromo-5-fluoropyridine
Found 4 products.