CAS 1256805-34-1

4-(Difluoromethyl)-3-pyridinecarboxaldehyde

Description:

4-(Difluoromethyl)-3-pyridinecarboxaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a difluoromethyl group (-CF2H) at the 4-position and an aldehyde functional group (-CHO) at the 3-position contributes to its unique reactivity and properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in medicinal chemistry and as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. The difluoromethyl group enhances the compound's lipophilicity and can influence its biological activity. Additionally, the aldehyde functionality allows for further chemical modifications, making it a versatile building block in organic synthesis. Safety precautions should be taken when handling this compound, as it may pose health risks, including irritation or toxicity. Proper storage and handling in a controlled environment are essential to ensure safety and stability.

Formula: C₇H₅F₂NO

InChI: InChI=1S/C7H5F2NO/c8-7(9)6-1-2-10-3-5(6)4-11/h1-4,7H

InChI key: InChIKey=GCNOPYGADFUUFJ-UHFFFAOYSA-N

SMILES: C(=O)C=1C(C(F)F)=CC=NC1

Synonyms:

• 4-(Difluoromethyl)-3-pyridinecarboxaldehyde
• 3-Pyridinecarboxaldehyde, 4-(difluoromethyl)-