
CAS 1256805-52-3
:2-Bromo-6H-pyrano[3,4-b]pyridin-5(8H)-one
Description:
2-Bromo-6H-pyrano[3,4-b]pyridin-5(8H)-one is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both pyridine and pyran rings. This compound features a bromine substituent at the 2-position, which can influence its reactivity and potential applications in organic synthesis. The presence of the carbonyl group in the pyridinone moiety contributes to its potential as a versatile building block in medicinal chemistry and materials science. Its molecular structure suggests that it may exhibit interesting biological activities, making it a candidate for further pharmacological studies. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its practical applications. Overall, 2-Bromo-6H-pyrano[3,4-b]pyridin-5(8H)-one represents a significant class of compounds in the realm of heterocyclic chemistry, with potential implications in drug development and synthetic methodologies.
Formula:C8H6BrNO2
InChI:InChI=1S/C8H6BrNO2/c9-8-2-1-5-6(10-8)3-12-4-7(5)11/h1-2H,3-4H2
InChI key:InChIKey=SZDVPBGIBQSCDB-UHFFFAOYSA-N
SMILES:O=C1C=2C(=NC(Br)=CC2)COC1
Synonyms:- 2-Bromo-6H-pyrano[3,4-b]pyridin-5(8H)-one
- 6H-Pyrano[3,4-b]pyridin-5(8H)-one, 2-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.