CAS 1256806-40-2

5,6-Dihydro-3-methyl-7H-pyrrolo[3,4-b]pyridin-7-one

Description:

5,6-Dihydro-3-methyl-7H-pyrrolo[3,4-b]pyridin-7-one is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings. This compound features a methyl group at the 3-position and a carbonyl group at the 7-position, contributing to its unique chemical properties. The presence of the dihydro group indicates that the compound has two hydrogen atoms added to the pyridine ring, which can influence its reactivity and stability. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The compound's structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. Its CAS number, 1256806-40-2, allows for easy identification and retrieval of information in chemical databases. As with many heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, which can be explored for synthetic applications. Overall, 5,6-Dihydro-3-methyl-7H-pyrrolo[3,4-b]pyridin-7-one represents a versatile scaffold in organic synthesis and pharmaceutical research.

Formula: C₈H₈N₂O

InChI: InChI=1S/C8H8N2O/c1-5-2-6-4-10-8(11)7(6)9-3-5/h2-3H,4H2,1H3,(H,10,11)

InChI key: InChIKey=ASLKXJXKIZSDRW-UHFFFAOYSA-N

SMILES: O=C1C=2C(CN1)=CC(C)=CN2

Synonyms:

• 5,6-Dihydro-3-methyl-7H-pyrrolo[3,4-b]pyridin-7-one
• 7H-Pyrrolo[3,4-b]pyridin-7-one, 5,6-dihydro-3-methyl-