CAS 1256807-19-8

2-(Chloromethyl)-5-methoxy-3-methylpyridine

Description:

2-(Chloromethyl)-5-methoxy-3-methylpyridine, identified by its CAS number 1256807-19-8, is a heterocyclic organic compound featuring a pyridine ring substituted with a chloromethyl group, a methoxy group, and a methyl group. This compound typically exhibits characteristics common to pyridine derivatives, such as being a polar, aromatic compound with potential basicity due to the nitrogen atom in the ring. The presence of the chloromethyl group suggests reactivity, particularly in nucleophilic substitution reactions, while the methoxy group can influence the compound's electronic properties and solubility. The methyl group contributes to the overall hydrophobic character of the molecule. In terms of applications, compounds like this may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to their potential biological activity. Additionally, the structural features may allow for further derivatization, making it a versatile intermediate in organic synthesis. Safety and handling considerations should be taken into account, as halogenated compounds can pose health risks.

Formula: C₈H₁₀ClNO

InChI: InChI=1S/C8H10ClNO/c1-6-3-7(11-2)5-10-8(6)4-9/h3,5H,4H2,1-2H3

InChI key: InChIKey=QPKWBIIRWLEWHL-UHFFFAOYSA-N

SMILES: O(C)C=1C=C(C)C(CCl)=NC1

Synonyms:

• Pyridine, 2-(chloromethyl)-5-methoxy-3-methyl-
• 2-(Chloromethyl)-5-methoxy-3-methylpyridine

Ilaprazole Impurity 103

CAS: 1256807-19-8

Formula: C₈H₁₀ClNO

Molecular weight: 171.62

Ref: 4Z-I-053105