
CAS 1256808-16-8
:3-(Trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine
Description:
3-(Trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which incorporates a trifluoromethyl group. This compound features a fused ring system that enhances its chemical stability and reactivity. The presence of the trifluoromethyl group significantly influences its electronic properties, making it a potent candidate for various applications in medicinal chemistry and material science. Typically, compounds of this nature exhibit interesting biological activities, potentially serving as intermediates in the synthesis of pharmaceuticals or agrochemicals. The trifluoromethyl moiety can enhance lipophilicity and metabolic stability, which are desirable traits in drug development. Additionally, the compound may exhibit specific interactions with biological targets due to its structural features, making it a subject of interest in research focused on developing new therapeutic agents. Overall, 3-(Trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine represents a valuable compound in the field of organic chemistry, particularly in the exploration of novel chemical entities.
Formula:C8H5F3N2
InChI:InChI=1S/C8H5F3N2/c9-8(10,11)5-4-13-6-2-1-3-12-7(5)6/h1-4,13H
InChI key:InChIKey=GKRYDJCIYBUYSO-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=2C(NC1)=CC=CN2
Synonyms:- 3-(Trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine
- 1H-Pyrrolo[3,2-b]pyridine, 3-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.