CymitQuimica logo

CAS 1256808-63-5

:

2-Chloro-1-(2-chloro-3-pyridinyl)ethanone

Description:
2-Chloro-1-(2-chloro-3-pyridinyl)ethanone is a chemical compound characterized by its unique structure, which includes a chloro-substituted ethanone moiety and a pyridine ring. The presence of chlorine atoms enhances its reactivity and potential applications in various chemical reactions. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which makes it useful in organic synthesis and pharmaceutical applications. The pyridine ring contributes to its aromatic properties, influencing its electronic characteristics and potential interactions with biological systems. As with many chlorinated compounds, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety precautions should be observed when handling this substance, as it may pose health risks due to its reactivity and potential toxicity. Overall, 2-Chloro-1-(2-chloro-3-pyridinyl)ethanone is a versatile compound with significant implications in chemical research and development.
Formula:C7H5Cl2NO
InChI:InChI=1S/C7H5Cl2NO/c8-4-6(11)5-2-1-3-10-7(5)9/h1-3H,4H2
InChI key:InChIKey=XAZSFSBECSEIFN-UHFFFAOYSA-N
SMILES:C(CCl)(=O)C1=C(Cl)N=CC=C1
Synonyms:
  • 2-Chloro-1-(2-chloro-3-pyridinyl)ethanone
  • Ethanone, 2-chloro-1-(2-chloro-3-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.