CAS 1256809-22-9

3-Methoxy-2-(4-piperidinyl)pyridine

Description:

3-Methoxy-2-(4-piperidinyl)pyridine, with the CAS number 1256809-22-9, is a chemical compound characterized by its pyridine ring substituted with a methoxy group and a piperidine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic structures, contributing to its potential biological activity. The presence of the methoxy group enhances its lipophilicity, which can influence its ability to cross biological membranes. The piperidine ring is known for its role in various pharmacological activities, often acting as a basic nitrogen-containing structure that can participate in hydrogen bonding and interact with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions, given the structural motifs that are often associated with such activities. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups, making it a subject of interest for further research in drug design and synthesis.

Formula: C₁₁H₁₆N₂O

InChI: InChI=1S/C11H16N2O/c1-14-10-3-2-6-13-11(10)9-4-7-12-8-5-9/h2-3,6,9,12H,4-5,7-8H2,1H3

InChI key: InChIKey=LARYKVZTPUITMV-UHFFFAOYSA-N

SMILES: O(C)C1=C(N=CC=C1)C2CCNCC2

Synonyms:

• 3-Methoxy-2-(4-piperidinyl)pyridine
• Pyridine, 3-methoxy-2-(4-piperidinyl)-