CymitQuimica logo

CAS 1256810-34-0

:

2-Bromo-5-hydroxynicotinic acid

Description:
2-Bromo-5-hydroxynicotinic acid is a chemical compound that belongs to the class of substituted pyridine derivatives. It features a bromine atom at the second position and a hydroxyl group at the fifth position of the nicotinic acid structure, which is a pyridine ring with a carboxylic acid functional group. This compound is characterized by its potential biological activity, particularly in medicinal chemistry, where it may exhibit properties relevant to pharmacology. The presence of the bromine atom can enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the hydroxyl group contributes to its polarity and solubility in polar solvents. 2-Bromo-5-hydroxynicotinic acid may also participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in organic synthesis. Its unique structural features and functional groups suggest potential applications in drug development and research related to nicotinic receptors or other biological pathways.
Formula:C6H4BrNO3
InChI:InChI=1S/C6H4BrNO3/c7-5-4(6(10)11)1-3(9)2-8-5/h1-2,9H,(H,10,11)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.