CymitQuimica logo

CAS 1256810-50-0

:

2-Bromo-6-chloro-N,N-dimethyl-3-pyridinamine

Description:
2-Bromo-6-chloro-N,N-dimethyl-3-pyridinamine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. The presence of bromine and chlorine substituents at the 2 and 6 positions, respectively, contributes to its reactivity and potential applications in various chemical reactions. The dimethylamino group at the 3-position enhances its basicity and solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Additionally, the presence of halogens can influence its electronic properties, making it suitable for further functionalization. Safety and handling precautions should be observed due to the presence of halogenated compounds, which may pose environmental and health risks. Overall, 2-Bromo-6-chloro-N,N-dimethyl-3-pyridinamine is a versatile compound with potential applications in both research and industry.
Formula:C7H8BrClN2
InChI:InChI=1S/C7H8BrClN2/c1-11(2)5-3-4-6(9)10-7(5)8/h3-4H,1-2H3
InChI key:InChIKey=WYVPRAURORYOIG-UHFFFAOYSA-N
SMILES:N(C)(C)C1=C(Br)N=C(Cl)C=C1
Synonyms:
  • 2-Bromo-6-chloro-N,N-dimethyl-3-pyridinamine
  • 3-Pyridinamine, 2-bromo-6-chloro-N,N-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.