
CAS 1256810-57-7
:5-Chloro-2-pyridinepropanamine
Description:
5-Chloro-2-pyridinepropanamine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 5-position of the pyridine ring and a propanamine side chain contributes to its unique properties. This compound is likely to exhibit basic characteristics due to the amine functional group, which can accept protons. The chlorine substituent may influence its reactivity and solubility in various solvents. Additionally, the structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with pyridine and amine functionalities are often explored for their biological activity. The compound's molecular interactions, such as hydrogen bonding and dipole-dipole interactions, can also play a significant role in its behavior in biological systems. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of 5-Chloro-2-pyridinepropanamine would need to be assessed in detail.
Formula:C8H11ClN2
InChI:InChI=1S/C8H11ClN2/c9-7-3-4-8(11-6-7)2-1-5-10/h3-4,6H,1-2,5,10H2
InChI key:InChIKey=GYMSLYFJVGFIDO-UHFFFAOYSA-N
SMILES:C(CCN)C1=CC=C(Cl)C=N1
Synonyms:- 5-Chloro-2-pyridinepropanamine
- 2-Pyridinepropanamine, 5-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.