CymitQuimica logo

CAS 1256810-61-3

:

2-Methyl-6-(methylamino)-4-pyridinecarbonitrile

Description:
2-Methyl-6-(methylamino)-4-pyridinecarbonitrile, with the CAS number 1256810-61-3, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methyl group and a methylamino group attached to the pyridine ring, contributing to its unique properties. The presence of the cyano group (–C≡N) indicates that it is a nitrile, which often imparts significant polarity and potential reactivity. The molecular structure suggests that it may exhibit basic properties due to the nitrogen atoms, which can participate in hydrogen bonding and coordination with metal ions. Additionally, the compound may have applications in pharmaceuticals or agrochemicals, given the functional groups that can influence biological activity. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, making it important to consider these factors in practical applications. Overall, this compound represents a versatile structure within organic chemistry.
Formula:C8H9N3
InChI:InChI=1S/C8H9N3/c1-6-3-7(5-9)4-8(10-2)11-6/h3-4H,1-2H3,(H,10,11)
InChI key:InChIKey=DNPQTJAASCALIO-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(NC)N=C(C)C1
Synonyms:
  • 4-Pyridinecarbonitrile, 2-methyl-6-(methylamino)-
  • 2-Methyl-6-(methylamino)-4-pyridinecarbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.