CymitQuimica logo

CAS 1256810-66-8

:

3-Bromo-5-(3-pyrrolidinyl)pyridine

Description:
3-Bromo-5-(3-pyrrolidinyl)pyridine is a chemical compound characterized by its pyridine ring structure, which is substituted at the 3-position with a bromine atom and at the 5-position with a pyrrolidine group. This compound features a heterocyclic aromatic system, contributing to its potential biological activity. The presence of the bromine atom enhances its reactivity and may influence its pharmacological properties, while the pyrrolidine moiety can impart specific steric and electronic characteristics that affect interactions with biological targets. Typically, such compounds are of interest in medicinal chemistry for their potential as drug candidates, particularly in the development of therapeutics targeting neurological or psychiatric disorders. The compound's solubility, stability, and reactivity can vary based on the conditions, such as pH and solvent, making it essential to consider these factors in practical applications. Overall, 3-Bromo-5-(3-pyrrolidinyl)pyridine exemplifies the complexity and utility of heterocyclic compounds in chemical research and drug development.
Formula:C9H11BrN2
InChI:InChI=1S/C9H11BrN2/c10-9-3-8(5-12-6-9)7-1-2-11-4-7/h3,5-7,11H,1-2,4H2
InChI key:InChIKey=FNFPSSBFQIHSSV-UHFFFAOYSA-N
SMILES:BrC1=CC(=CN=C1)C2CCNC2
Synonyms:
  • Pyridine, 3-bromo-5-(3-pyrrolidinyl)-
  • 3-Bromo-5-(3-pyrrolidinyl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.