
CAS 1256811-10-5
:3-Methoxy-5-(trifluoromethyl)-2-pyridinemethanamine
Description:
3-Methoxy-5-(trifluoromethyl)-2-pyridinemethanamine is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a methoxy group (-OCH3) at the 3-position and a trifluoromethyl group (-CF3) at the 5-position significantly influences its chemical properties, including its reactivity and polarity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the methoxy group. The trifluoromethyl group enhances its lipophilicity and can affect its biological activity, making it of interest in medicinal chemistry. The amine functional group (-NH2) contributes to its basicity and potential for forming hydrogen bonds, which can be relevant in various chemical reactions and interactions. Overall, 3-Methoxy-5-(trifluoromethyl)-2-pyridinemethanamine is a compound with unique structural features that may impart specific pharmacological properties, making it a candidate for further research in drug development and related fields.
Formula:C8H9F3N2O
InChI:InChI=1S/C8H9F3N2O/c1-14-7-2-5(8(9,10)11)4-13-6(7)3-12/h2,4H,3,12H2,1H3
InChI key:InChIKey=SZGHRDYULDFXKL-UHFFFAOYSA-N
SMILES:O(C)C1=C(CN)N=CC(C(F)(F)F)=C1
Synonyms:- 2-Pyridinemethanamine, 3-methoxy-5-(trifluoromethyl)-
- 3-Methoxy-5-(trifluoromethyl)-2-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.