CymitQuimica logo

CAS 1256811-59-2

:

4-Chloro-3-ethynyl-2-methoxypyridine

Description:
4-Chloro-3-ethynyl-2-methoxypyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The compound features a chloro substituent at the 4-position, an ethynyl group at the 3-position, and a methoxy group at the 2-position of the pyridine ring. These functional groups contribute to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The ethynyl group introduces a triple bond, which can participate in further chemical reactions, while the methoxy group can influence the compound's solubility and polarity. The presence of the chlorine atom may enhance the compound's biological activity or stability. Overall, 4-Chloro-3-ethynyl-2-methoxypyridine is of interest for its unique structural features and potential utility in synthetic chemistry and medicinal applications. As with any chemical substance, handling should be conducted with appropriate safety measures due to potential toxicity or reactivity.
Formula:C8H6ClNO
InChI:InChI=1S/C8H6ClNO/c1-3-6-7(9)4-5-10-8(6)11-2/h1,4-5H,2H3
InChI key:InChIKey=MVROFEDDLSLWPB-UHFFFAOYSA-N
SMILES:O(C)C1=C(C#C)C(Cl)=CC=N1
Synonyms:
  • 4-Chloro-3-ethynyl-2-methoxypyridine
  • Pyridine, 4-chloro-3-ethynyl-2-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.