CAS 1256811-93-4

6-Chloro-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid

Description:

6-Chloro-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid is a heterocyclic compound characterized by its pyrazolo-pyridine structure, which features a fused pyrazole and pyridine ring system. The presence of a chlorine atom at the 6-position and a carboxylic acid functional group at the 3-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. It is of interest in medicinal chemistry and drug development, particularly for its potential biological activities, including anti-inflammatory and anti-cancer properties. The compound's reactivity can be influenced by the electron-withdrawing nature of the chlorine atom and the acidic hydrogen of the carboxylic group, making it a versatile intermediate for further chemical modifications. As with many heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are valuable in synthetic organic chemistry.

Formula: C₇H₄ClN₃O₂

InChI: InChI=1S/C7H4ClN3O2/c8-4-2-1-3-5(7(12)13)10-11-6(3)9-4/h1-2H,(H,12,13)(H,9,10,11)

InChI key: InChIKey=LWXPHPQEMALIIV-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(NN1)=NC(Cl)=CC2

Synonyms:

• 6-Chloro-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid
• 1H-Pyrazolo[3,4-b]pyridine-3-carboxylic acid, 6-chloro-

1H-Pyrazolo[3,4-b]pyridine-3-carboxylic acid, 6-chloro-

CAS: 1256811-93-4

Formula: C₇H₄ClN₃O₂

Purity: 97%

Molecular weight: 197.5786

Ref: IN-DA01QTVN