CAS 1256812-24-4

5-Chloro-2-ethynyl-3-methylpyridine

Description:

5-Chloro-2-ethynyl-3-methylpyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chloro substituent at the 5-position and an ethynyl group at the 2-position, along with a methyl group at the 3-position, contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The ethynyl group introduces a triple bond, which can participate in various chemical reactions, including coupling reactions and nucleophilic additions. Additionally, the chlorine atom can influence the reactivity and polarity of the molecule. Safety data sheets should be consulted for handling and storage guidelines, as halogenated compounds can pose health and environmental risks. Overall, 5-Chloro-2-ethynyl-3-methylpyridine is a valuable compound in synthetic organic chemistry.

Formula: C₈H₆ClN

InChI: InChI=1S/C8H6ClN/c1-3-8-6(2)4-7(9)5-10-8/h1,4-5H,2H3

InChI key: InChIKey=MRVYFCYKUDRLNC-UHFFFAOYSA-N

SMILES: C(#C)C1=C(C)C=C(Cl)C=N1

Synonyms:

• 5-Chloro-2-ethynyl-3-methylpyridine
• Pyridine, 5-chloro-2-ethynyl-3-methyl-