
CAS 1256813-20-3
:2-Chloro-5-(difluoromethyl)-3-pyridinecarboxylic acid
Description:
2-Chloro-5-(difluoromethyl)-3-pyridinecarboxylic acid is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloro group at the 2-position and a difluoromethyl group at the 5-position significantly influences its chemical reactivity and properties. This compound is likely to exhibit acidic behavior due to the carboxylic acid functional group, which can donate protons in solution. The difluoromethyl group introduces unique electronic and steric effects, potentially enhancing lipophilicity and influencing biological activity. Additionally, the chlorine atom can participate in various substitution reactions, making the compound versatile in synthetic applications. Its molecular structure suggests potential uses in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety and handling precautions should be observed due to the presence of halogenated groups, which may pose environmental and health risks. Overall, this compound represents a complex interplay of functional groups that can lead to diverse chemical behavior.
Formula:C7H4ClF2NO2
InChI:InChI=1S/C7H4ClF2NO2/c8-5-4(7(12)13)1-3(2-11-5)6(9)10/h1-2,6H,(H,12,13)
InChI key:InChIKey=LQGYBZFCUSEOGP-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C(F)F)C=NC1Cl
Synonyms:- 2-Chloro-5-(difluoromethyl)-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 2-chloro-5-(difluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.