CymitQuimica logo

CAS 1256815-08-3

:

Hexahydro-2-methylimidazo[1,5-a]pyrazin-3(2H)-one

Description:
Hexahydro-2-methylimidazo[1,5-a]pyrazin-3(2H)-one is a heterocyclic organic compound characterized by its bicyclic structure, which includes both imidazole and pyrazine rings. This compound features a saturated framework, indicated by the "hexahydro" prefix, suggesting the presence of multiple hydrogen atoms that contribute to its stability and solubility. The methyl group at the second position of the imidazole ring enhances its lipophilicity, potentially influencing its biological activity and interactions. The presence of the carbonyl group in the pyrazinone structure may contribute to its reactivity and ability to participate in various chemical reactions. Hexahydro-2-methylimidazo[1,5-a]pyrazin-3(2H)-one is of interest in medicinal chemistry and pharmacology, as compounds with similar structures often exhibit diverse biological activities, including antimicrobial and anticancer properties. Its specific applications and effects would depend on further studies and evaluations in the context of drug development and therapeutic use.
Formula:C7H13N3O
InChI:InChI=1S/C7H13N3O/c1-9-5-6-4-8-2-3-10(6)7(9)11/h6,8H,2-5H2,1H3
InChI key:InChIKey=FNPLZEGCLDXUNX-UHFFFAOYSA-N
SMILES:O=C1N2C(CN1C)CNCC2
Synonyms:
  • Imidazo[1,5-a]pyrazin-3(2H)-one, hexahydro-2-methyl-
  • Hexahydro-2-methylimidazo[1,5-a]pyrazin-3(2H)-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.