
CAS 1256816-76-8
:5-Chloro-3-methoxy-2-methylpyridine
Description:
5-Chloro-3-methoxy-2-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with a chlorine atom, a methoxy group, and a methyl group. The presence of the chlorine atom at the 5-position and the methoxy group at the 3-position contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The methyl group at the 2-position influences the compound's steric and electronic properties, which can affect its behavior in chemical reactions. This compound may exhibit polar characteristics due to the methoxy group, making it soluble in polar solvents. It is often utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Additionally, the presence of halogen and methoxy substituents can enhance its biological activity, making it of interest in medicinal chemistry. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate potential hazards associated with its use.
Formula:C7H8ClNO
InChI:InChI=1S/C7H8ClNO/c1-5-7(10-2)3-6(8)4-9-5/h3-4H,1-2H3
InChI key:InChIKey=KGUDEVLTHMPTBZ-UHFFFAOYSA-N
SMILES:O(C)C1=C(C)N=CC(Cl)=C1
Synonyms:- Pyridine, 5-chloro-3-methoxy-2-methyl-
- 5-Chloro-3-methoxy-2-methylpyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.