CAS 1256817-44-3
:2-Cyclopropyl-5-ethynylpyridine
Description:
2-Cyclopropyl-5-ethynylpyridine is an organic compound characterized by its unique structural features, which include a pyridine ring substituted with a cyclopropyl group and an ethynyl group. The presence of the pyridine ring imparts basicity and aromaticity to the molecule, while the cyclopropyl group contributes to its three-membered ring structure, which can influence the compound's reactivity and steric properties. The ethynyl group, characterized by a triple bond between carbon atoms, enhances the compound's potential for further chemical reactions, such as coupling reactions or addition reactions. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary depending on the solvent and conditions used. Additionally, the presence of multiple functional groups suggests that it may participate in various chemical transformations, making it a versatile building block in organic synthesis. Overall, 2-Cyclopropyl-5-ethynylpyridine is a compound of interest for research and development in various chemical applications.
Formula:C10H9N
InChI:InChI=1S/C10H9N/c1-2-8-3-6-10(11-7-8)9-4-5-9/h1,3,6-7,9H,4-5H2
InChI key:InChIKey=FONCFFVGYOOJQS-UHFFFAOYSA-N
SMILES:C(#C)C1=CC=C(N=C1)C2CC2
Synonyms:- Pyridine, 2-cyclopropyl-5-ethynyl-
- 2-Cyclopropyl-5-ethynylpyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
