CAS 1256819-69-8

Ethanone, 1-[5-methoxy-2-(trifluoromethyl)-4-pyridinyl]-

Description:

Ethanone, 1-[5-methoxy-2-(trifluoromethyl)-4-pyridinyl]- is a chemical compound characterized by its pyridine ring, which is substituted with a methoxy group and a trifluoromethyl group. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The methoxy group contributes to the compound's overall polarity and can affect its solubility in various solvents. This compound is likely to exhibit specific reactivity patterns typical of ketones, such as nucleophilic addition reactions. Additionally, the pyridine moiety may participate in coordination with metal ions or engage in hydrogen bonding interactions. The compound's unique structure suggests potential applications in pharmaceuticals, particularly in the development of agents targeting specific biological pathways. As with many organic compounds, its stability, reactivity, and potential toxicity would need to be evaluated in the context of its intended use.

Formula: C₉H₈F₃NO₂

InChI: InChI=1S/C9H8F3NO2/c1-5(14)6-3-8(9(10,11)12)13-4-7(6)15-2/h3-4H,1-2H3

InChI key: InChIKey=RKCJHGFWGIMUCH-UHFFFAOYSA-N

SMILES: C(C)(=O)C=1C(OC)=CN=C(C(F)(F)F)C1

Synonyms:

• 1-(5-Methoxy-2-(trifluoromethyl)pyridin-4-yl)ethanone
• Ethanone, 1-[5-methoxy-2-(trifluoromethyl)-4-pyridinyl]-