
CAS 1256819-97-2
:5-(4-Piperidinyl)-2-(trifluoromethyl)pyridine
Description:
5-(4-Piperidinyl)-2-(trifluoromethyl)pyridine, identified by its CAS number 1256819-97-2, is a chemical compound characterized by its pyridine ring structure substituted with a piperidine group and a trifluoromethyl group. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The piperidine moiety contributes to the compound's potential as a ligand in various biological systems, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structural features suggest potential applications in drug discovery, particularly in the synthesis of compounds with specific pharmacological properties. As with many fluorinated compounds, it may also exhibit stability under various conditions, making it suitable for further chemical modifications or as a building block in complex organic synthesis. Safety and handling precautions should be observed due to the presence of fluorine and the potential for biological activity.
Formula:C11H13F3N2
InChI:InChI=1S/C11H13F3N2/c12-11(13,14)10-2-1-9(7-16-10)8-3-5-15-6-4-8/h1-2,7-8,15H,3-6H2
InChI key:InChIKey=NFRFEQFJEBTINJ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=CC(=CN1)C2CCNCC2
Synonyms:- 5-(4-Piperidinyl)-2-(trifluoromethyl)pyridine
- Pyridine, 5-(4-piperidinyl)-2-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.