CymitQuimica logo

CAS 1256821-69-8

:

4-[3-(4-Piperidinyl)-1,2,4-oxadiazol-5-yl]pyridine

Description:
4-[3-(4-Piperidinyl)-1,2,4-oxadiazol-5-yl]pyridine, identified by its CAS number 1256821-69-8, is a chemical compound that features a pyridine ring substituted with a 1,2,4-oxadiazole moiety and a piperidine group. This compound is characterized by its heterocyclic structure, which contributes to its potential biological activity. The presence of the oxadiazole ring suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The piperidine group enhances the compound's solubility and may influence its pharmacokinetic properties. Additionally, the compound's unique structural features may impart specific reactivity and stability characteristics, making it of interest in various chemical synthesis and research applications. Overall, 4-[3-(4-Piperidinyl)-1,2,4-oxadiazol-5-yl]pyridine represents a class of compounds that could be explored for their therapeutic potential and utility in drug design.
Formula:C12H14N4O
InChI:InChI=1S/C12H14N4O/c1-5-13-6-2-9(1)11-15-12(17-16-11)10-3-7-14-8-4-10/h3-4,7-9,13H,1-2,5-6H2
InChI key:InChIKey=KIIAEBNUANLOJT-UHFFFAOYSA-N
SMILES:C=1(N=C(ON1)C=2C=CN=CC2)C3CCNCC3
Synonyms:
  • Pyridine, 4-[3-(4-piperidinyl)-1,2,4-oxadiazol-5-yl]-
  • 4-[3-(4-Piperidinyl)-1,2,4-oxadiazol-5-yl]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.