CAS 1256821-90-5
:1-[5-Chloro-4-(trifluoromethyl)-2-pyridinyl]ethanone
Description:
1-[5-Chloro-4-(trifluoromethyl)-2-pyridinyl]ethanone is a chemical compound characterized by its pyridine ring, which is substituted with a chlorine atom and a trifluoromethyl group. The presence of these substituents contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The compound features a ketone functional group, which can participate in various chemical reactions, such as nucleophilic addition. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly due to the presence of the trifluoromethyl group, which is known to enhance the metabolic stability and bioactivity of organic compounds. Additionally, the chlorine atom may influence the compound's reactivity and interaction with biological targets. As with many halogenated compounds, it is essential to consider environmental and safety aspects during handling and application. Overall, 1-[5-Chloro-4-(trifluoromethyl)-2-pyridinyl]ethanone represents a versatile structure with potential utility in various chemical and biological contexts.
Formula:C8H5ClF3NO
InChI:InChI=1S/C8H5ClF3NO/c1-4(14)7-2-5(8(10,11)12)6(9)3-13-7/h2-3H,1H3
InChI key:InChIKey=KXDJDXDDXJPIKZ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C(C)=O)N=CC1Cl
Synonyms:- Ethanone, 1-[5-chloro-4-(trifluoromethyl)-2-pyridinyl]-
- 1-[5-Chloro-4-(trifluoromethyl)-2-pyridinyl]ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-[5-Chloro-4-(trifluoromethyl)-2-pyridinyl]ethanone
CAS:Controlled ProductFormula:C8H5ClF3NOColor and Shape:NeatMolecular weight:223.58
